C14H16Cl2N2OS — CID 60907800
1-[3,5-dichloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]butan-2-amine (PubChem CID 60907800) has the molecular formula C14H16Cl2N2OS and a molecular weight of 331.27 g/mol. Its IUPAC name is 1-[3,5-dichloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]butan-2-amine.
| Compound Name | 1-[3,5-dichloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 60907800 |
| Molecular Formula | C14H16Cl2N2OS |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-[3,5-dichloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(Cl)cc(Cl)c1OCc1cscn1 |
| InChI | InChI=1S/C14H16Cl2N2OS/c1-2-11(17)4-9-3-10(15)5-13(16)14(9)19-6-12-7-20-8-18-12/h3,5,7-8,11H,2,4,6,17H2,1H3 |
| InChIKey | DWNDTDPCFAVLOA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |