C18H22N2O — CID 170895047
1-[2-(cyclopropylmethoxy)-5-phenylphenyl]ethane-1,2-diamine (PubChem CID 170895047) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)-5-phenylphenyl]ethane-1,2-diamine.
| Compound Name | 1-[2-(cyclopropylmethoxy)-5-phenylphenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 170895047 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)-5-phenylphenyl]ethane-1,2-diamine |
| SMILES | NCC(N)c1cc(-c2ccccc2)ccc1OCC1CC1 |
| InChI | InChI=1S/C18H22N2O/c19-11-17(20)16-10-15(14-4-2-1-3-5-14)8-9-18(16)21-12-13-6-7-13/h1-5,8-10,13,17H,6-7,11-12,19-20H2 |
| InChIKey | MOSFWDLHBGDPLV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |