C24H31N2OP — CID 170898114
[(2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]piperidin-1-yl]-diphenylphosphane (PubChem CID 170898114) has the molecular formula C24H31N2OP and a molecular weight of 394.50 g/mol. Its IUPAC name is [(2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]piperidin-1-yl]-diphenylphosphane.
| Compound Name | [(2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]piperidin-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 170898114 |
| Molecular Formula | C24H31N2OP |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | [(2S)-2-[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]piperidin-1-yl]-diphenylphosphane |
| SMILES | CC(C)(C)[C@H]1COC([C@@H]2CCCCN2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C24H31N2OP/c1-24(2,3)22-18-27-23(25-22)21-16-10-11-17-26(21)28(19-12-6-4-7-13-19)20-14-8-5-9-15-20/h4-9,12-15,21-22H,10-11,16-18H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | DQRJCMMRWBKYSJ-FCHUYYIVSA-N |
| XLogP | 4.73 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|