About 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile
2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile (PubChem CID 170902602) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile.
Molecular Properties
| Compound Name | 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile |
| PubChem CID | 170902602 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile |
| SMILES | N#Cc1cccc2c1NC(=O)OC2 |
| InChI | InChI=1S/C9H6N2O2/c10-4-6-2-1-3-7-5-13-9(12)11-8(6)7/h1-3H,5H2,(H,11,12) |
| InChIKey | ZLESXOMLGPPCJC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile?
The IUPAC name of 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile (CID 170902602) is 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile.
What is the SMILES notation for 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile?
The canonical SMILES for 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile is N#Cc1cccc2c1NC(=O)OC2.
What is the InChIKey of 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile?
The InChIKey is ZLESXOMLGPPCJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c10-4-6-2-1-3-7-5-13-9(12)11-8(6)7/h1-3H,5H2,(H,11,12).
What are the key properties of 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile?
2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile has a molecular weight of 174.16 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1,4-dihydro-3,1-benzoxazine-8-carbonitrile is sourced from PubChem (CID 170902602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).