C9H13ClN2O2S — CID 170902776
(5-cyclopropylsulfonyl-2-pyridinyl)methanamine;hydrochloride (PubChem CID 170902776) has the molecular formula C9H13ClN2O2S and a molecular weight of 248.73 g/mol. Its IUPAC name is (5-cyclopropylsulfonyl-2-pyridinyl)methanamine;hydrochloride.
| Compound Name | (5-cyclopropylsulfonyl-2-pyridinyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 170902776 |
| Molecular Formula | C9H13ClN2O2S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (5-cyclopropylsulfonyl-2-pyridinyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1ccc(S(=O)(=O)C2CC2)cn1 |
| InChI | InChI=1S/C9H12N2O2S.ClH/c10-5-7-1-2-9(6-11-7)14(12,13)8-3-4-8;/h1-2,6,8H,3-5,10H2;1H |
| InChIKey | PKEBIYKLEDCEOF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |