C10H14BF3N4O4 — CID 170905245
(2-piperazin-1-ylpyrimidin-5-yl)boronic acid;2,2,2-trifluoroacetic acid (PubChem CID 170905245) has the molecular formula C10H14BF3N4O4 and a molecular weight of 322.05 g/mol. Its IUPAC name is (2-piperazin-1-ylpyrimidin-5-yl)boronic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2-piperazin-1-ylpyrimidin-5-yl)boronic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170905245 |
| Molecular Formula | C10H14BF3N4O4 |
| Molecular Weight | 322.05 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (2-piperazin-1-ylpyrimidin-5-yl)boronic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OB(O)c1cnc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C8H13BN4O2.C2HF3O2/c14-9(15)7-5-11-8(12-6-7)13-3-1-10-2-4-13;3-2(4,5)1(6)7/h5-6,10,14-15H,1-4H2;(H,6,7) |
| InChIKey | ZHOQHCGGSFSDDT-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.05 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|