C9H16Cl2N2S — CID 170905802
2-(4-methylpiperidin-4-yl)-1,3-thiazole;dihydrochloride (PubChem CID 170905802) has the molecular formula C9H16Cl2N2S and a molecular weight of 255.21 g/mol. Its IUPAC name is 2-(4-methylpiperidin-4-yl)-1,3-thiazole;dihydrochloride.
| Compound Name | 2-(4-methylpiperidin-4-yl)-1,3-thiazole;dihydrochloride |
|---|---|
| PubChem CID | 170905802 |
| Molecular Formula | C9H16Cl2N2S |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(4-methylpiperidin-4-yl)-1,3-thiazole;dihydrochloride |
| SMILES | CC1(c2nccs2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C9H14N2S.2ClH/c1-9(2-4-10-5-3-9)8-11-6-7-12-8;;/h6-7,10H,2-5H2,1H3;2*1H |
| InChIKey | FCPSWGQGVCTNFB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |