C14H25ClN2O2 — CID 170905947
ethyl 2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride (PubChem CID 170905947) has the molecular formula C14H25ClN2O2 and a molecular weight of 288.82 g/mol. Its IUPAC name is ethyl 2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride.
| Compound Name | ethyl 2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 170905947 |
| Molecular Formula | C14H25ClN2O2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | ethyl 2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CC2C(CN1)NC1CCCCC12.Cl |
| InChI | InChI=1S/C14H24N2O2.ClH/c1-2-18-14(17)12-7-10-9-5-3-4-6-11(9)16-13(10)8-15-12;/h9-13,15-16H,2-8H2,1H3;1H |
| InChIKey | GCKRPSFFSHFQRO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |