C10H19N3O2 — CID 170906156
5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbohydrazide (PubChem CID 170906156) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbohydrazide.
| Compound Name | 5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 170906156 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 5-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carbohydrazide |
| SMILES | COC1CCC2NC(C(=O)NN)CC2C1 |
| InChI | InChI=1S/C10H19N3O2/c1-15-7-2-3-8-6(4-7)5-9(12-8)10(14)13-11/h6-9,12H,2-5,11H2,1H3,(H,13,14) |
| InChIKey | IUZJWBXNZAHKFT-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|