2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid

C9H14F2O3 — CID 170909956

IUPAC2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid
SMILESCC(C)(C(=O)O)C1(O)CCCC1(F)F
InChIInChI=1S/C9H14F2O3/c1-7(2,6(12)13)8(14)4-3-5-9(8,10)11/h14H,3-5H2,1-2H3,(H,12,13)
InChIKeySNMPMWXGMWXHFH-UHFFFAOYSA-N
MW208.20 g/mol
LogP1.65
Rot. Bonds2

About 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid

2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid (PubChem CID 170909956) has the molecular formula C9H14F2O3 and a molecular weight of 208.20 g/mol. Its IUPAC name is 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid.

Molecular Properties

Compound Name2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid
PubChem CID170909956
Molecular FormulaC9H14F2O3
Molecular Weight208.20 g/mol
Exact Mass208.09
IUPAC Name2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid
SMILESCC(C)(C(=O)O)C1(O)CCCC1(F)F
InChIInChI=1S/C9H14F2O3/c1-7(2,6(12)13)8(14)4-3-5-9(8,10)11/h14H,3-5H2,1-2H3,(H,12,13)
InChIKeySNMPMWXGMWXHFH-UHFFFAOYSA-N
XLogP1.65
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.20
LogP ≤ 51.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid?
The IUPAC name of 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid (CID 170909956) is 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid.
What is the SMILES notation for 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid?
The canonical SMILES for 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid is CC(C)(C(=O)O)C1(O)CCCC1(F)F.
What is the InChIKey of 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid?
The InChIKey is SNMPMWXGMWXHFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O3/c1-7(2,6(12)13)8(14)4-3-5-9(8,10)11/h14H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid?
2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid has a molecular weight of 208.20 g/mol, XLogP of 1.65, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoro-1-hydroxycyclopentyl)-2-methylpropanoic acid is sourced from PubChem (CID 170909956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).