C21H20Cl2F3N3O — CID 170912582
2-chloro-1-[4-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]piperidin-1-yl]ethanone;hydrochloride (PubChem CID 170912582) has the molecular formula C21H20Cl2F3N3O and a molecular weight of 458.31 g/mol. Its IUPAC name is 2-chloro-1-[4-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]piperidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-chloro-1-[4-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]piperidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 170912582 |
| Molecular Formula | C21H20Cl2F3N3O |
| Molecular Weight | 458.31 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-chloro-1-[4-[2-[4-(trifluoromethyl)phenyl]benzimidazol-1-yl]piperidin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(CCl)N1CCC(n2c(-c3ccc(C(F)(F)F)cc3)nc3ccccc32)CC1 |
| InChI | InChI=1S/C21H19ClF3N3O.ClH/c22-13-19(29)27-11-9-16(10-12-27)28-18-4-2-1-3-17(18)26-20(28)14-5-7-15(8-6-14)21(23,24)25;/h1-8,16H,9-13H2;1H |
| InChIKey | DYDCLDAFTMCFAF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.31 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|