C13H11N3O3 — CID 170916723
(Z)-2-cyano-3-(5-methylfuran-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 170916723) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is (Z)-2-cyano-3-(5-methylfuran-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(5-methylfuran-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916723 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (Z)-2-cyano-3-(5-methylfuran-2-yl)-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C(C#N)=C\c2ccc(C)o2)no1 |
| InChI | InChI=1S/C13H11N3O3/c1-8-3-4-11(18-8)6-10(7-14)13(17)15-12-5-9(2)19-16-12/h3-6H,1-2H3,(H,15,16,17)/b10-6- |
| InChIKey | UUBBFEBFIBNAPZ-POHAHGRESA-N |
| XLogP | 2.43 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|