C14H21F6N2O4S2+ — CID 170920333
ethyl-dimethyl-(2-phenylethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 170920333) has the molecular formula C14H21F6N2O4S2+ and a molecular weight of 459.45 g/mol. Its IUPAC name is ethyl-dimethyl-(2-phenylethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | ethyl-dimethyl-(2-phenylethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 170920333 |
| Molecular Formula | C14H21F6N2O4S2+ |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | ethyl-dimethyl-(2-phenylethyl)azanium;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | CC[N+](C)(C)CCc1ccccc1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20N.C2HF6NO4S2/c1-4-13(2,3)11-10-12-8-6-5-7-9-12;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-9H,4,10-11H2,1-3H3;9H/q+1; |
| InChIKey | MFBXNLUAKKNPBG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|