C19H23N5O3 — CID 170920910
2-[4-[[(4,6-dimethylpyrimidin-2-yl)diazenyl]methyl]phenoxy]-1-morpholin-4-ylethanone (PubChem CID 170920910) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-[4-[[(4,6-dimethylpyrimidin-2-yl)diazenyl]methyl]phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[4-[[(4,6-dimethylpyrimidin-2-yl)diazenyl]methyl]phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 170920910 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[4-[[(4,6-dimethylpyrimidin-2-yl)diazenyl]methyl]phenoxy]-1-morpholin-4-ylethanone |
| SMILES | Cc1cc(C)nc(/N=N/Cc2ccc(OCC(=O)N3CCOCC3)cc2)n1 |
| InChI | InChI=1S/C19H23N5O3/c1-14-11-15(2)22-19(21-14)23-20-12-16-3-5-17(6-4-16)27-13-18(25)24-7-9-26-10-8-24/h3-6,11H,7-10,12-13H2,1-2H3/b23-20+ |
| InChIKey | PWHYAUKSZOYKLA-BSYVCWPDSA-N |
| XLogP | 2.61 |
| TPSA | 89.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|