C16H14F2O5S — CID 170921074
2-(2,4-difluorophenyl)sulfonyl-1-(3,4-dimethoxyphenyl)ethenol (PubChem CID 170921074) has the molecular formula C16H14F2O5S and a molecular weight of 356.35 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfonyl-1-(3,4-dimethoxyphenyl)ethenol.
| Compound Name | 2-(2,4-difluorophenyl)sulfonyl-1-(3,4-dimethoxyphenyl)ethenol |
|---|---|
| PubChem CID | 170921074 |
| Molecular Formula | C16H14F2O5S |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfonyl-1-(3,4-dimethoxyphenyl)ethenol |
| SMILES | COc1ccc(C(O)=CS(=O)(=O)c2ccc(F)cc2F)cc1OC |
| InChI | InChI=1S/C16H14F2O5S/c1-22-14-5-3-10(7-15(14)23-2)13(19)9-24(20,21)16-6-4-11(17)8-12(16)18/h3-9,19H,1-2H3 |
| InChIKey | ZFMRYLSTTMAVRI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|