C16H15FO5S — CID 75527706
1-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)sulfonylethanone (PubChem CID 75527706) has the molecular formula C16H15FO5S and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)sulfonylethanone.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)sulfonylethanone |
|---|---|
| PubChem CID | 75527706 |
| Molecular Formula | C16H15FO5S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(2-fluorophenyl)sulfonylethanone |
| SMILES | COc1ccc(C(=O)CS(=O)(=O)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C16H15FO5S/c1-21-14-8-7-11(9-15(14)22-2)13(18)10-23(19,20)16-6-4-3-5-12(16)17/h3-9H,10H2,1-2H3 |
| InChIKey | NZVDXVGBILRNEV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |