C13H14N2O4 — CID 170921455
2-benzyl-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid (PubChem CID 170921455) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-benzyl-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid.
| Compound Name | 2-benzyl-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 170921455 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-benzyl-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1[nH]n(Cc2ccccc2)c(=O)c1CCO |
| InChI | InChI=1S/C13H14N2O4/c16-7-6-10-11(13(18)19)14-15(12(10)17)8-9-4-2-1-3-5-9/h1-5,14,16H,6-8H2,(H,18,19) |
| InChIKey | SZJJFTKZGSFTPR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |