C12H22N4O5 — CID 170922655
N-(2-methoxyethyl)-3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide (PubChem CID 170922655) has the molecular formula C12H22N4O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide.
| Compound Name | N-(2-methoxyethyl)-3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide |
|---|---|
| PubChem CID | 170922655 |
| Molecular Formula | C12H22N4O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(2-methoxyethyl)-3-[2-[2-(2-methoxyethylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide |
| SMILES | COCCNC(=O)C=C(C)NNC(=O)C(=O)NCCOC |
| InChI | InChI=1S/C12H22N4O5/c1-9(8-10(17)13-4-6-20-2)15-16-12(19)11(18)14-5-7-21-3/h8,15H,4-7H2,1-3H3,(H,13,17)(H,14,18)(H,16,19) |
| InChIKey | KCUUXECVRGDDQK-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|