C12H22N4O3 — CID 5017552
N-ethyl-3-[2-[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide (PubChem CID 5017552) has the molecular formula C12H22N4O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is N-ethyl-3-[2-[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide.
| Compound Name | N-ethyl-3-[2-[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide |
|---|---|
| PubChem CID | 5017552 |
| Molecular Formula | C12H22N4O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-ethyl-3-[2-[2-(2-methylpropylamino)-2-oxoacetyl]hydrazinyl]but-2-enamide |
| SMILES | CCNC(=O)C=C(C)NNC(=O)C(=O)NCC(C)C |
| InChI | InChI=1S/C12H22N4O3/c1-5-13-10(17)6-9(4)15-16-12(19)11(18)14-7-8(2)3/h6,8,15H,5,7H2,1-4H3,(H,13,17)(H,14,18)(H,16,19) |
| InChIKey | SODAFQTVNZXCOY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|