C11H21N3O2 — CID 4565784
N-butan-2-yl-3-(2-propanoylhydrazinyl)but-2-enamide (PubChem CID 4565784) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is N-butan-2-yl-3-(2-propanoylhydrazinyl)but-2-enamide.
| Compound Name | N-butan-2-yl-3-(2-propanoylhydrazinyl)but-2-enamide |
|---|---|
| PubChem CID | 4565784 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | N-butan-2-yl-3-(2-propanoylhydrazinyl)but-2-enamide |
| SMILES | CCC(=O)NNC(C)=CC(=O)NC(C)CC |
| InChI | InChI=1S/C11H21N3O2/c1-5-8(3)12-11(16)7-9(4)13-14-10(15)6-2/h7-8,13H,5-6H2,1-4H3,(H,12,16)(H,14,15) |
| InChIKey | WXEMGWYIVGUKRL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|