C11H8F6O5 — CID 170923103
4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylic acid (PubChem CID 170923103) has the molecular formula C11H8F6O5 and a molecular weight of 334.17 g/mol. Its IUPAC name is 4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylic acid.
| Compound Name | 4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 170923103 |
| Molecular Formula | C11H8F6O5 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-oxo-3-(2,2,2-trifluoroacetyl)-5-(2,2,2-trifluoro-1-hydroxyethylidene)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(=C(O)C(F)(F)F)C(=O)C(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H8F6O5/c12-10(13,14)7(19)4-1-3(9(21)22)2-5(6(4)18)8(20)11(15,16)17/h3-4,20H,1-2H2,(H,21,22) |
| InChIKey | INHGLDODERKHSV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|