C9H8N2O3S3 — CID 170923985
methyl 5-[(5-sulfanylidene-2H-1,3,4-thiadiazol-2-yl)sulfanylmethyl]furan-2-carboxylate (PubChem CID 170923985) has the molecular formula C9H8N2O3S3 and a molecular weight of 288.38 g/mol. Its IUPAC name is methyl 5-[(5-sulfanylidene-2H-1,3,4-thiadiazol-2-yl)sulfanylmethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(5-sulfanylidene-2H-1,3,4-thiadiazol-2-yl)sulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 170923985 |
| Molecular Formula | C9H8N2O3S3 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | methyl 5-[(5-sulfanylidene-2H-1,3,4-thiadiazol-2-yl)sulfanylmethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(CSC2N=NC(=S)S2)o1 |
| InChI | InChI=1S/C9H8N2O3S3/c1-13-7(12)6-3-2-5(14-6)4-16-9-11-10-8(15)17-9/h2-3,9H,4H2,1H3 |
| InChIKey | GGDPDXNPLAFXFU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|