C18H10Br2N2O2 — CID 170924030
1,4-bis(4-bromophenyl)-1,2-dihydropyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 170924030) has the molecular formula C18H10Br2N2O2 and a molecular weight of 446.10 g/mol. Its IUPAC name is 1,4-bis(4-bromophenyl)-1,2-dihydropyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis(4-bromophenyl)-1,2-dihydropyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 170924030 |
| Molecular Formula | C18H10Br2N2O2 |
| Molecular Weight | 446.10 g/mol |
| Exact Mass | 443.91 |
| IUPAC Name | 1,4-bis(4-bromophenyl)-1,2-dihydropyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | O=C1N=C(c2ccc(Br)cc2)C2=C1C(c1ccc(Br)cc1)NC2=O |
| InChI | InChI=1S/C18H10Br2N2O2/c19-11-5-1-9(2-6-11)15-13-14(18(24)21-15)16(22-17(13)23)10-3-7-12(20)8-4-10/h1-8,15H,(H,21,24) |
| InChIKey | FEEYKOGXNNEDLJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |