C22H15BrCl2N2O — CID 45112828
5-(4-bromophenyl)-4,6-bis(4-chlorophenyl)-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 45112828) has the molecular formula C22H15BrCl2N2O and a molecular weight of 474.19 g/mol. Its IUPAC name is 5-(4-bromophenyl)-4,6-bis(4-chlorophenyl)-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5-(4-bromophenyl)-4,6-bis(4-chlorophenyl)-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 45112828 |
| Molecular Formula | C22H15BrCl2N2O |
| Molecular Weight | 474.19 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 5-(4-bromophenyl)-4,6-bis(4-chlorophenyl)-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | O=C1NC(c2ccc(Cl)cc2)=C(c2ccc(Br)cc2)C(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C22H15BrCl2N2O/c23-16-7-1-13(2-8-16)19-20(14-3-9-17(24)10-4-14)26-22(28)27-21(19)15-5-11-18(25)12-6-15/h1-12,20H,(H2,26,27,28) |
| InChIKey | LMCRJGMQAVYZNM-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.19 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|