C18H14Cl2N2OS2 — CID 42612774
methyl 4,6-bis(4-chlorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbodithioate (PubChem CID 42612774) has the molecular formula C18H14Cl2N2OS2 and a molecular weight of 409.36 g/mol. Its IUPAC name is methyl 4,6-bis(4-chlorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbodithioate.
| Compound Name | methyl 4,6-bis(4-chlorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbodithioate |
|---|---|
| PubChem CID | 42612774 |
| Molecular Formula | C18H14Cl2N2OS2 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | methyl 4,6-bis(4-chlorophenyl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carbodithioate |
| SMILES | CSC(=S)C1=C(c2ccc(Cl)cc2)NC(=O)NC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N2OS2/c1-25-17(24)14-15(10-2-6-12(19)7-3-10)21-18(23)22-16(14)11-4-8-13(20)9-5-11/h2-9,15H,1H3,(H2,21,22,23) |
| InChIKey | SIWBUQHSRUISRV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|