C19H18N2O2S2 — CID 42612770
methyl 4-(4-methoxyphenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carbodithioate (PubChem CID 42612770) has the molecular formula C19H18N2O2S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is methyl 4-(4-methoxyphenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carbodithioate.
| Compound Name | methyl 4-(4-methoxyphenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carbodithioate |
|---|---|
| PubChem CID | 42612770 |
| Molecular Formula | C19H18N2O2S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | methyl 4-(4-methoxyphenyl)-2-oxo-6-phenyl-3,4-dihydro-1H-pyrimidine-5-carbodithioate |
| SMILES | COc1ccc(C2NC(=O)NC(c3ccccc3)=C2C(=S)SC)cc1 |
| InChI | InChI=1S/C19H18N2O2S2/c1-23-14-10-8-13(9-11-14)17-15(18(24)25-2)16(20-19(22)21-17)12-6-4-3-5-7-12/h3-11,17H,1-2H3,(H2,20,21,22) |
| InChIKey | SYVMZWAQZMBHQF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|