C24H22N2O2 — CID 6990662
(4S)-5-benzyl-6-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 6990662) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (4S)-5-benzyl-6-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | (4S)-5-benzyl-6-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 6990662 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (4S)-5-benzyl-6-(4-methoxyphenyl)-4-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | COc1ccc(C2=C(Cc3ccccc3)[C@H](c3ccccc3)NC(=O)N2)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-28-20-14-12-19(13-15-20)23-21(16-17-8-4-2-5-9-17)22(25-24(27)26-23)18-10-6-3-7-11-18/h2-15,22H,16H2,1H3,(H2,25,26,27)/t22-/m0/s1 |
| InChIKey | HYVCMCSMSYHZRF-QFIPXVFZSA-N |
| XLogP | 4.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |