C14H25NO4 — CID 170924654
tert-butyl (3S)-4-hydroxy-3-methyl-2-oxa-1-azaspiro[4.5]decane-8-carboxylate (PubChem CID 170924654) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl (3S)-4-hydroxy-3-methyl-2-oxa-1-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl (3S)-4-hydroxy-3-methyl-2-oxa-1-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 170924654 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl (3S)-4-hydroxy-3-methyl-2-oxa-1-azaspiro[4.5]decane-8-carboxylate |
| SMILES | C[C@@H]1ONC2(CCC(C(=O)OC(C)(C)C)CC2)C1O |
| InChI | InChI=1S/C14H25NO4/c1-9-11(16)14(15-19-9)7-5-10(6-8-14)12(17)18-13(2,3)4/h9-11,15-16H,5-8H2,1-4H3/t9-,10?,11?,14?/m0/s1 |
| InChIKey | FAAOEGPYRCZXMM-ICYBPSJXSA-N |
| XLogP | 1.54 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |