C18H23FN4 — CID 170925547
5-(4-fluorophenyl)-N-(1-propan-2-ylpiperidin-3-yl)pyrimidin-2-amine (PubChem CID 170925547) has the molecular formula C18H23FN4 and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(1-propan-2-ylpiperidin-3-yl)pyrimidin-2-amine.
| Compound Name | 5-(4-fluorophenyl)-N-(1-propan-2-ylpiperidin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 170925547 |
| Molecular Formula | C18H23FN4 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(1-propan-2-ylpiperidin-3-yl)pyrimidin-2-amine |
| SMILES | CC(C)N1CCCC(Nc2ncc(-c3ccc(F)cc3)cn2)C1 |
| InChI | InChI=1S/C18H23FN4/c1-13(2)23-9-3-4-17(12-23)22-18-20-10-15(11-21-18)14-5-7-16(19)8-6-14/h5-8,10-11,13,17H,3-4,9,12H2,1-2H3,(H,20,21,22) |
| InChIKey | DOICHVAJKAAESP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |