C12H7ClF4N2 — CID 170925615
2-chloro-5-[2-fluoro-4-(trifluoromethyl)phenyl]-4-methylpyrimidine (PubChem CID 170925615) has the molecular formula C12H7ClF4N2 and a molecular weight of 290.65 g/mol. Its IUPAC name is 2-chloro-5-[2-fluoro-4-(trifluoromethyl)phenyl]-4-methylpyrimidine.
| Compound Name | 2-chloro-5-[2-fluoro-4-(trifluoromethyl)phenyl]-4-methylpyrimidine |
|---|---|
| PubChem CID | 170925615 |
| Molecular Formula | C12H7ClF4N2 |
| Molecular Weight | 290.65 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2-chloro-5-[2-fluoro-4-(trifluoromethyl)phenyl]-4-methylpyrimidine |
| SMILES | Cc1nc(Cl)ncc1-c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H7ClF4N2/c1-6-9(5-18-11(13)19-6)8-3-2-7(4-10(8)14)12(15,16)17/h2-5H,1H3 |
| InChIKey | IFNOYNIZDVUPAJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.65 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |