C18H19N3O4 — CID 170927699
(3S)-3-(6-oxospiro[4,8-dihydro-3H-pyrano[3,2-f]isoindole-2,3'-azetidine]-7-yl)piperidine-2,6-dione (PubChem CID 170927699) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (3S)-3-(6-oxospiro[4,8-dihydro-3H-pyrano[3,2-f]isoindole-2,3'-azetidine]-7-yl)piperidine-2,6-dione.
| Compound Name | (3S)-3-(6-oxospiro[4,8-dihydro-3H-pyrano[3,2-f]isoindole-2,3'-azetidine]-7-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170927699 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3S)-3-(6-oxospiro[4,8-dihydro-3H-pyrano[3,2-f]isoindole-2,3'-azetidine]-7-yl)piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3cc4c(cc3C2=O)CCC2(CNC2)O4)C(=O)N1 |
| InChI | InChI=1S/C18H19N3O4/c22-15-2-1-13(16(23)20-15)21-7-11-6-14-10(5-12(11)17(21)24)3-4-18(25-14)8-19-9-18/h5-6,13,19H,1-4,7-9H2,(H,20,22,23)/t13-/m0/s1 |
| InChIKey | SOVWZJXHKXJROI-ZDUSSCGKSA-N |
| XLogP | 0.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|