C19H21N3O4 — CID 169202846
3-(7-oxospiro[1,5-dihydrofuro[3,4-f]isoindole-3,4'-piperidine]-6-yl)piperidine-2,6-dione (PubChem CID 169202846) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-(7-oxospiro[1,5-dihydrofuro[3,4-f]isoindole-3,4'-piperidine]-6-yl)piperidine-2,6-dione.
| Compound Name | 3-(7-oxospiro[1,5-dihydrofuro[3,4-f]isoindole-3,4'-piperidine]-6-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 169202846 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-(7-oxospiro[1,5-dihydrofuro[3,4-f]isoindole-3,4'-piperidine]-6-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc4c(cc3C2=O)COC42CCNCC2)C(=O)N1 |
| InChI | InChI=1S/C19H21N3O4/c23-16-2-1-15(17(24)21-16)22-9-11-8-14-12(7-13(11)18(22)25)10-26-19(14)3-5-20-6-4-19/h7-8,15,20H,1-6,9-10H2,(H,21,23,24) |
| InChIKey | RFOWJKPCMRQXAX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|