C23H29N3O3S — CID 171829377
3-[6-(3-azaspiro[5.5]undecan-9-ylsulfanyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171829377) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-[6-(3-azaspiro[5.5]undecan-9-ylsulfanyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(3-azaspiro[5.5]undecan-9-ylsulfanyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171829377 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-[6-(3-azaspiro[5.5]undecan-9-ylsulfanyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(SC4CCC5(CCNCC5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H29N3O3S/c27-20-4-3-19(21(28)25-20)26-14-15-13-17(1-2-18(15)22(26)29)30-16-5-7-23(8-6-16)9-11-24-12-10-23/h1-2,13,16,19,24H,3-12,14H2,(H,25,27,28) |
| InChIKey | SASOBMHIVKBUIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|