C15H14F18O3Sn — CID 170928066
tris[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy]-prop-2-enylstannane (PubChem CID 170928066) has the molecular formula C15H14F18O3Sn and a molecular weight of 702.95 g/mol. Its IUPAC name is tris[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy]-prop-2-enylstannane.
| Compound Name | tris[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy]-prop-2-enylstannane |
|---|---|
| PubChem CID | 170928066 |
| Molecular Formula | C15H14F18O3Sn |
| Molecular Weight | 702.95 g/mol |
| Exact Mass | 703.97 |
| IUPAC Name | tris[(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxy]-prop-2-enylstannane |
| SMILES | C=CC[Sn](OC(C)(C(F)(F)F)C(F)(F)F)(OC(C)(C(F)(F)F)C(F)(F)F)OC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/3C4H3F6O.C3H5.Sn/c3*1-2(11,3(5,6)7)4(8,9)10;1-3-2;/h3*1H3;3H,1-2H2;/q3*-1;;+3 |
| InChIKey | CTEBSXNXWFVRHN-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.95 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|