C56H57NSSi3 — CID 170930237
(3-carbazol-9-ylphenyl)-dibenzothiophen-4-yl-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane (PubChem CID 170930237) has the molecular formula C56H57NSSi3 and a molecular weight of 860.40 g/mol. Its IUPAC name is (3-carbazol-9-ylphenyl)-dibenzothiophen-4-yl-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane.
| Compound Name | (3-carbazol-9-ylphenyl)-dibenzothiophen-4-yl-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane |
|---|---|
| PubChem CID | 170930237 |
| Molecular Formula | C56H57NSSi3 |
| Molecular Weight | 860.40 g/mol |
| Exact Mass | 859.35 |
| IUPAC Name | (3-carbazol-9-ylphenyl)-dibenzothiophen-4-yl-(1,1,4,4-tetramethyl-2,3-dihydro-1,4-benzodisilin-6-yl)-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane |
| SMILES | CC1(C)CCC(C)(C)c2cc([Si](c3cccc(-n4c5ccccc5c5ccccc54)c3)(c3ccc4c(c3)[Si](C)(C)CC[Si]4(C)C)c3cccc4c3sc3ccccc34)ccc21 |
| InChI | InChI=1S/C56H57NSSi3/c1-55(2)31-32-56(3,4)47-36-40(27-29-46(47)55)61(41-28-30-51-53(37-41)60(7,8)34-33-59(51,5)6,52-26-16-22-45-44-21-11-14-25-50(44)58-54(45)52)39-18-15-17-38(35-39)57-48-23-12-9-19-42(48)43-20-10-13-24-49(43)57/h9-30,35-37H,31-34H2,1-8H3 |
| InChIKey | ZBFBANFWGNGHNI-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.40 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|