C75H77N5Si — CID 171590175
[3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane (PubChem CID 171590175) has the molecular formula C75H77N5Si and a molecular weight of 1076.56 g/mol. Its IUPAC name is [3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane.
| Compound Name | [3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane |
|---|---|
| PubChem CID | 171590175 |
| Molecular Formula | C75H77N5Si |
| Molecular Weight | 1076.56 g/mol |
| Exact Mass | 1075.59 |
| IUPAC Name | [3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)silane |
| SMILES | CC1(C)CCC(C)(C)c2cc([Si](c3cccc(-c4nc(-n5c6ccccc6c6ccccc65)nc(-n5c6ccccc6c6ccccc65)n4)c3)(c3ccc4c(c3)C(C)(C)CCC4(C)C)c3ccc4c(c3)C(C)(C)CCC4(C)C)ccc21 |
| InChI | InChI=1S/C75H77N5Si/c1-70(2)38-41-73(7,8)60-45-50(32-35-57(60)70)81(51-33-36-58-61(46-51)74(9,10)42-39-71(58,3)4,52-34-37-59-62(47-52)75(11,12)43-40-72(59,5)6)49-23-21-22-48(44-49)67-76-68(79-63-28-17-13-24-53(63)54-25-14-18-29-64(54)79)78-69(77-67)80-65-30-19-15-26-55(65)56-27-16-20-31-66(56)80/h13-37,44-47H,38-43H2,1-12H3 |
| InChIKey | QZMWFQRFPWRFNU-UHFFFAOYSA-N |
| XLogP | 16.16 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1076.56 |
| LogP ≤ 5 | 16.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|