C69H71N5Si7 — CID 170930242
[3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)silane (PubChem CID 170930242) has the molecular formula C69H71N5Si7 and a molecular weight of 1166.96 g/mol. Its IUPAC name is [3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)silane.
| Compound Name | [3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)silane |
|---|---|
| PubChem CID | 170930242 |
| Molecular Formula | C69H71N5Si7 |
| Molecular Weight | 1166.96 g/mol |
| Exact Mass | 1165.41 |
| IUPAC Name | [3-[4,6-di(carbazol-9-yl)-1,3,5-triazin-2-yl]phenyl]-tris(1,8-dimethyl-1,8-disilatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-4-yl)silane |
| SMILES | C[Si]12CC[Si](C)(CC1)c1cc([Si](c3cccc(-c4nc(-n5c6ccccc6c6ccccc65)nc(-n5c6ccccc6c6ccccc65)n4)c3)(c3ccc4c(c3)[Si]3(C)CC[Si]4(C)CC3)c3ccc4c(c3)[Si]3(C)CC[Si]4(C)CC3)ccc12 |
| InChI | InChI=1S/C69H71N5Si7/c1-75-32-38-78(4,39-33-75)64-45-50(26-29-61(64)75)81(51-27-30-62-65(46-51)79(5)40-34-76(62,2)35-41-79,52-28-31-63-66(47-52)80(6)42-36-77(63,3)37-43-80)49-17-15-16-48(44-49)67-70-68(73-57-22-11-7-18-53(57)54-19-8-12-23-58(54)73)72-69(71-67)74-59-24-13-9-20-55(59)56-21-10-14-25-60(56)74/h7-31,44-47H,32-43H2,1-6H3 |
| InChIKey | LPYQGUCYJXODRU-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1166.96 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|