C59H48N4OSi — CID 171723602
[3-[4-dibenzofuran-3-yl-6-(7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazol-5-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane (PubChem CID 171723602) has the molecular formula C59H48N4OSi and a molecular weight of 857.15 g/mol. Its IUPAC name is [3-[4-dibenzofuran-3-yl-6-(7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazol-5-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[4-dibenzofuran-3-yl-6-(7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazol-5-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 171723602 |
| Molecular Formula | C59H48N4OSi |
| Molecular Weight | 857.15 g/mol |
| Exact Mass | 856.36 |
| IUPAC Name | [3-[4-dibenzofuran-3-yl-6-(7,7,10,10-tetramethyl-8,9-dihydrobenzo[b]carbazol-5-yl)-1,3,5-triazin-2-yl]phenyl]-triphenylsilane |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)c1ccccc1n3-c1nc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccccc3)c2)nc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C59H48N4OSi/c1-58(2)33-34-59(3,4)50-38-52-48(37-49(50)58)45-27-14-16-29-51(45)63(52)57-61-55(60-56(62-57)40-31-32-47-46-28-15-17-30-53(46)64-54(47)36-40)39-19-18-26-44(35-39)65(41-20-8-5-9-21-41,42-22-10-6-11-23-42)43-24-12-7-13-25-43/h5-32,35-38H,33-34H2,1-4H3 |
| InChIKey | PAENVQXCFNYADO-UHFFFAOYSA-N |
| XLogP | 11.93 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.15 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|