C46H32N4OPt-2 — CID 170930447
CID 170930447 (PubChem CID 170930447) has the molecular formula C46H32N4OPt-2 and a molecular weight of 851.87 g/mol.
| Compound Name | CID 170930447 |
|---|---|
| PubChem CID | 170930447 |
| Molecular Formula | C46H32N4OPt-2 |
| Molecular Weight | 851.87 g/mol |
| Exact Mass | 851.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[C-]=[N+]6c7ccccc7-c7cccc(c76)-c6ccccc65)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C46H32N4O.Pt/c1-46(2,3)30-24-25-47-44(26-30)50-42-21-9-6-14-34(42)37-23-22-33(28-43(37)50)51-32-13-10-12-31(27-32)48-29-49-41-20-8-5-16-36(41)39-18-11-17-38(45(39)49)35-15-4-7-19-40(35)48;/h4-26H,1-3H3;/q-2; |
| InChIKey | YRKCWLNURZVCPD-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 33.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.87 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|