C18H9ClN2O — CID 170931258
6-(5-chloro-2-pyridinyl)dibenzofuran-3-carbonitrile (PubChem CID 170931258) has the molecular formula C18H9ClN2O and a molecular weight of 304.74 g/mol. Its IUPAC name is 6-(5-chloro-2-pyridinyl)dibenzofuran-3-carbonitrile.
| Compound Name | 6-(5-chloro-2-pyridinyl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 170931258 |
| Molecular Formula | C18H9ClN2O |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 6-(5-chloro-2-pyridinyl)dibenzofuran-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)oc1c(-c3ccc(Cl)cn3)cccc12 |
| InChI | InChI=1S/C18H9ClN2O/c19-12-5-7-16(21-10-12)15-3-1-2-14-13-6-4-11(9-20)8-17(13)22-18(14)15/h1-8,10H |
| InChIKey | NIJLKTQIFTYYGR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |