C26H25FN6O2 — CID 170931468
1-[4-[4-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 170931468) has the molecular formula C26H25FN6O2 and a molecular weight of 472.52 g/mol. Its IUPAC name is 1-[4-[4-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170931468 |
| Molecular Formula | C26H25FN6O2 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1-[4-[4-[3-fluoro-4-(pyridin-2-ylmethoxy)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2c[nH]c3ncnc(Nc4ccc(OCc5ccccn5)c(F)c4)c23)CC1 |
| InChI | InChI=1S/C26H25FN6O2/c1-2-23(34)33-11-8-17(9-12-33)20-14-29-25-24(20)26(31-16-30-25)32-18-6-7-22(21(27)13-18)35-15-19-5-3-4-10-28-19/h2-7,10,13-14,16-17H,1,8-9,11-12,15H2,(H2,29,30,31,32) |
| InChIKey | AQLQEHVHNANCRG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|