C25H28ClN7O2 — CID 170746866
1-[4-[4-[4-[(E)-3-amino-2-methanimidoylbut-2-enoxy]-3-chloroanilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 170746866) has the molecular formula C25H28ClN7O2 and a molecular weight of 494.00 g/mol. Its IUPAC name is 1-[4-[4-[4-[(E)-3-amino-2-methanimidoylbut-2-enoxy]-3-chloroanilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[4-[4-[(E)-3-amino-2-methanimidoylbut-2-enoxy]-3-chloroanilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170746866 |
| Molecular Formula | C25H28ClN7O2 |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 1-[4-[4-[4-[(E)-3-amino-2-methanimidoylbut-2-enoxy]-3-chloroanilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/C(COc1ccc(Nc2ncnc3[nH]cc(C4CCN(C(=O)C=C)CC4)c23)cc1Cl)=C(/C)N |
| InChI | InChI=1S/C25H28ClN7O2/c1-3-22(34)33-8-6-16(7-9-33)19-12-29-24-23(19)25(31-14-30-24)32-18-4-5-21(20(26)10-18)35-13-17(11-27)15(2)28/h3-5,10-12,14,16,27H,1,6-9,13,28H2,2H3,(H2,29,30,31,32)/b17-15+,27-11+ |
| InChIKey | UPDSAZXNJFEJGJ-RHOKTZJXSA-N |
| XLogP | 4.51 |
| TPSA | 133.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|