C48H55N3O2 — CID 170935877
(4R)-2-[3-[3-(7-tert-butyl-3,5,5-trimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-5-(2,4,6-trimethylphenyl)phenyl]-4-methyl-4-propan-2-yl-5H-1,3-oxazole (PubChem CID 170935877) has the molecular formula C48H55N3O2 and a molecular weight of 705.99 g/mol. Its IUPAC name is (4R)-2-[3-[3-(7-tert-butyl-3,5,5-trimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-5-(2,4,6-trimethylphenyl)phenyl]-4-methyl-4-propan-2-yl-5H-1,3-oxazole.
| Compound Name | (4R)-2-[3-[3-(7-tert-butyl-3,5,5-trimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-5-(2,4,6-trimethylphenyl)phenyl]-4-methyl-4-propan-2-yl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 170935877 |
| Molecular Formula | C48H55N3O2 |
| Molecular Weight | 705.99 g/mol |
| Exact Mass | 705.43 |
| IUPAC Name | (4R)-2-[3-[3-(7-tert-butyl-3,5,5-trimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-5-(2,4,6-trimethylphenyl)phenyl]-4-methyl-4-propan-2-yl-5H-1,3-oxazole |
| SMILES | Cc1cc(Oc2cc(C3=N[C@](C)(C(C)C)CO3)cc(-c3c(C)cc(C)cc3C)c2)cc(N2c3ccc(C(C)(C)C)cc3C(C)(C)c3cc(C)cnc32)c1 |
| InChI | InChI=1S/C48H55N3O2/c1-28(2)48(13)27-52-45(50-48)35-21-34(43-32(6)16-29(3)17-33(43)7)22-39(23-35)53-38-19-30(4)18-37(25-38)51-42-15-14-36(46(8,9)10)24-40(42)47(11,12)41-20-31(5)26-49-44(41)51/h14-26,28H,27H2,1-13H3/t48-/m0/s1 |
| InChIKey | BGDRNFLSWPYPEY-DYVQZXGMSA-N |
| XLogP | 12.68 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.99 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |