C41H47N3O2 — CID 170932697
(4R)-2-[5-[3-(7-tert-butyl-5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4-cyclopentyl-4,5-dihydro-1,3-oxazole (PubChem CID 170932697) has the molecular formula C41H47N3O2 and a molecular weight of 613.85 g/mol. Its IUPAC name is (4R)-2-[5-[3-(7-tert-butyl-5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4-cyclopentyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2-[5-[3-(7-tert-butyl-5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4-cyclopentyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 170932697 |
| Molecular Formula | C41H47N3O2 |
| Molecular Weight | 613.85 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | (4R)-2-[5-[3-(7-tert-butyl-5,5-dimethylbenzo[b][1,8]naphthyridin-10-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4-cyclopentyl-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cc(Oc2cc(C3=N[C@H](C4CCCC4)CO3)c(C)cc2C)cc(N2c3ccc(C(C)(C)C)cc3C(C)(C)c3cccnc32)c1 |
| InChI | InChI=1S/C41H47N3O2/c1-25-18-30(44-36-16-15-29(40(4,5)6)21-34(36)41(7,8)33-14-11-17-42-38(33)44)22-31(19-25)46-37-23-32(26(2)20-27(37)3)39-43-35(24-45-39)28-12-9-10-13-28/h11,14-23,28,35H,9-10,12-13,24H2,1-8H3/t35-/m0/s1 |
| InChIKey | GCXBTPHMUVLRCC-DHUJRADRSA-N |
| XLogP | 10.54 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.85 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |