C44H45N3O2 — CID 170934814
(3aR,8bS)-5-tert-butyl-2-[5-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4,8b-dihydro-3aH-indeno[2,1-d][1,3]oxazole (PubChem CID 170934814) has the molecular formula C44H45N3O2 and a molecular weight of 647.86 g/mol. Its IUPAC name is (3aR,8bS)-5-tert-butyl-2-[5-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4,8b-dihydro-3aH-indeno[2,1-d][1,3]oxazole.
| Compound Name | (3aR,8bS)-5-tert-butyl-2-[5-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4,8b-dihydro-3aH-indeno[2,1-d][1,3]oxazole |
|---|---|
| PubChem CID | 170934814 |
| Molecular Formula | C44H45N3O2 |
| Molecular Weight | 647.86 g/mol |
| Exact Mass | 647.35 |
| IUPAC Name | (3aR,8bS)-5-tert-butyl-2-[5-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-2,4-dimethylphenyl]-4,8b-dihydro-3aH-indeno[2,1-d][1,3]oxazole |
| SMILES | Cc1cc(Oc2cc(C3=N[C@@H]4Cc5c(cccc5C(C)(C)C)[C@@H]4O3)c(C)cc2C)cc(-n2c3ccc(C(C)(C)C)cc3c3cccnc32)c1 |
| InChI | InChI=1S/C44H45N3O2/c1-25-18-29(47-38-16-15-28(43(4,5)6)21-35(38)32-13-11-17-45-41(32)47)22-30(19-25)48-39-24-33(26(2)20-27(39)3)42-46-37-23-34-31(40(37)49-42)12-10-14-36(34)44(7,8)9/h10-22,24,37,40H,23H2,1-9H3/t37-,40+/m1/s1 |
| InChIKey | BGKALBCPCYGBHM-PJKFIHJXSA-N |
| XLogP | 10.93 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.86 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |