C47H43N3O2 — CID 170935565
(3aS,9aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-6,7-dimethyl-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzoxazole (PubChem CID 170935565) has the molecular formula C47H43N3O2 and a molecular weight of 681.88 g/mol. Its IUPAC name is (3aS,9aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-6,7-dimethyl-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzoxazole.
| Compound Name | (3aS,9aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-6,7-dimethyl-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzoxazole |
|---|---|
| PubChem CID | 170935565 |
| Molecular Formula | C47H43N3O2 |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 681.34 |
| IUPAC Name | (3aS,9aS)-2-[3-[3-tert-butyl-5-(6-methylpyrido[2,3-b]indol-9-yl)phenoxy]-5-phenylphenyl]-6,7-dimethyl-3a,4,9,9a-tetrahydrobenzo[f][1,3]benzoxazole |
| SMILES | Cc1ccc2c(c1)c1cccnc1n2-c1cc(Oc2cc(C3=N[C@H]4Cc5cc(C)c(C)cc5C[C@@H]4O3)cc(-c3ccccc3)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C47H43N3O2/c1-28-14-15-43-41(17-28)40-13-10-16-48-45(40)50(43)37-25-36(47(4,5)6)26-39(27-37)51-38-21-34(31-11-8-7-9-12-31)20-35(22-38)46-49-42-23-32-18-29(2)30(3)19-33(32)24-44(42)52-46/h7-22,25-27,42,44H,23-24H2,1-6H3/t42-,44-/m0/s1 |
| InChIKey | ZATVHYCQBBIHGY-YMJVKMAGSA-N |
| XLogP | 11.17 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |