C45H47N3O2 — CID 170935278
(3aS,8bR)-2-[3-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[1,2-d][1,3]oxazole (PubChem CID 170935278) has the molecular formula C45H47N3O2 and a molecular weight of 663.90 g/mol. Its IUPAC name is (3aS,8bR)-2-[3-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[1,2-d][1,3]oxazole.
| Compound Name | (3aS,8bR)-2-[3-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[1,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 170935278 |
| Molecular Formula | C45H47N3O2 |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.38 |
| IUPAC Name | (3aS,8bR)-2-[3-[3-(6-tert-butylpyrido[2,3-b]indol-9-yl)-5-methylphenoxy]-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[1,2-d][1,3]oxazole |
| SMILES | [2H]C1([2H])c2c(ccc(C)c2C)[C@@]2(C)N=C(c3cc(Oc4cc(C)cc(-n5c6ccc(C(C)(C)C)cc6c6cccnc65)c4)cc(C(C)C)c3)O[C@@]12C |
| InChI | InChI=1S/C45H47N3O2/c1-26(2)30-20-31(42-47-45(10)39-15-13-28(4)29(5)38(39)25-44(45,9)50-42)22-35(21-30)49-34-19-27(3)18-33(24-34)48-40-16-14-32(43(6,7)8)23-37(40)36-12-11-17-46-41(36)48/h11-24,26H,25H2,1-10H3/t44-,45+/m0/s1/i25D2 |
| InChIKey | ZPRQGVLGDYPMBR-APEHONCKSA-N |
| XLogP | 11.32 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |