C47H51N3O2 — CID 170935186
(3aR,8bS)-2-[3-[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethylacridin-3-yl]oxy-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[2,1-d][1,3]oxazole (PubChem CID 170935186) has the molecular formula C47H51N3O2 and a molecular weight of 691.96 g/mol. Its IUPAC name is (3aR,8bS)-2-[3-[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethylacridin-3-yl]oxy-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[2,1-d][1,3]oxazole.
| Compound Name | (3aR,8bS)-2-[3-[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethylacridin-3-yl]oxy-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[2,1-d][1,3]oxazole |
|---|---|
| PubChem CID | 170935186 |
| Molecular Formula | C47H51N3O2 |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.41 |
| IUPAC Name | (3aR,8bS)-2-[3-[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethylacridin-3-yl]oxy-5-propan-2-ylphenyl]-4,4-dideuterio-3a,5,6,8b-tetramethylindeno[2,1-d][1,3]oxazole |
| SMILES | [2H]C1([2H])c2c(ccc(C)c2C)[C@]2(C)OC(c3cc(Oc4ccc5c(c4)N(c4cc(C(C)(C)C)ccn4)c4ccccc4C5(C)C)cc(C(C)C)c3)=N[C@]12C |
| InChI | InChI=1S/C47H51N3O2/c1-28(2)31-22-32(43-49-46(10)27-36-30(4)29(3)16-18-37(36)47(46,11)52-43)24-35(23-31)51-34-17-19-39-41(26-34)50(40-15-13-12-14-38(40)45(39,8)9)42-25-33(20-21-48-42)44(5,6)7/h12-26,28H,27H2,1-11H3/t46-,47+/m1/s1/i27D2 |
| InChIKey | XLSAQHUWLZZXTP-HZXNNSEZSA-N |
| XLogP | 12.03 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |