C59H64N4O — CID 176783350
10-(4-tert-butyl-2-pyridinyl)-3-[2-tert-butyl-4-(2,4,6-trimethylphenyl)-5-[3-(2,4,6-trimethylphenyl)-2H-benzimidazol-1-yl]phenoxy]-9,9-dimethylacridine (PubChem CID 176783350) has the molecular formula C59H64N4O and a molecular weight of 845.19 g/mol. Its IUPAC name is 10-(4-tert-butyl-2-pyridinyl)-3-[2-tert-butyl-4-(2,4,6-trimethylphenyl)-5-[3-(2,4,6-trimethylphenyl)-2H-benzimidazol-1-yl]phenoxy]-9,9-dimethylacridine.
| Compound Name | 10-(4-tert-butyl-2-pyridinyl)-3-[2-tert-butyl-4-(2,4,6-trimethylphenyl)-5-[3-(2,4,6-trimethylphenyl)-2H-benzimidazol-1-yl]phenoxy]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 176783350 |
| Molecular Formula | C59H64N4O |
| Molecular Weight | 845.19 g/mol |
| Exact Mass | 844.51 |
| IUPAC Name | 10-(4-tert-butyl-2-pyridinyl)-3-[2-tert-butyl-4-(2,4,6-trimethylphenyl)-5-[3-(2,4,6-trimethylphenyl)-2H-benzimidazol-1-yl]phenoxy]-9,9-dimethylacridine |
| SMILES | Cc1cc(C)c(-c2cc(C(C)(C)C)c(Oc3ccc4c(c3)N(c3cc(C(C)(C)C)ccn3)c3ccccc3C4(C)C)cc2N2CN(c3c(C)cc(C)cc3C)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C59H64N4O/c1-36-27-38(3)55(39(4)28-36)44-33-47(58(10,11)12)53(34-51(44)61-35-62(50-22-18-17-21-49(50)61)56-40(5)29-37(2)30-41(56)6)64-43-23-24-46-52(32-43)63(48-20-16-15-19-45(48)59(46,13)14)54-31-42(25-26-60-54)57(7,8)9/h15-34H,35H2,1-14H3 |
| InChIKey | RYJZONHPBCUXHN-UHFFFAOYSA-N |
| XLogP | 16.34 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.19 |
| LogP ≤ 5 | 16.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |