C53H59N4O+ — CID 176782437
10-(4-tert-butyl-2-pyridinyl)-3-[3-[4,6-ditert-butyl-3-(2,4-dimethylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9,9-dimethylacridine (PubChem CID 176782437) has the molecular formula C53H59N4O+ and a molecular weight of 768.08 g/mol. Its IUPAC name is 10-(4-tert-butyl-2-pyridinyl)-3-[3-[4,6-ditert-butyl-3-(2,4-dimethylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9,9-dimethylacridine.
| Compound Name | 10-(4-tert-butyl-2-pyridinyl)-3-[3-[4,6-ditert-butyl-3-(2,4-dimethylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 176782437 |
| Molecular Formula | C53H59N4O+ |
| Molecular Weight | 768.08 g/mol |
| Exact Mass | 767.47 |
| IUPAC Name | 10-(4-tert-butyl-2-pyridinyl)-3-[3-[4,6-ditert-butyl-3-(2,4-dimethylphenyl)benzimidazol-3-ium-1-yl]phenoxy]-9,9-dimethylacridine |
| SMILES | Cc1ccc(-[n+]2cn(-c3cccc(Oc4ccc5c(c4)N(c4cc(C(C)(C)C)ccn4)c4ccccc4C5(C)C)c3)c3cc(C(C)(C)C)cc(C(C)(C)C)c32)c(C)c1 |
| InChI | InChI=1S/C53H59N4O/c1-34-21-24-44(35(2)27-34)56-33-55(47-29-37(51(6,7)8)28-43(49(47)56)52(9,10)11)38-17-16-18-39(31-38)58-40-22-23-42-46(32-40)57(45-20-15-14-19-41(45)53(42,12)13)48-30-36(25-26-54-48)50(3,4)5/h14-33H,1-13H3/q+1 |
| InChIKey | VNHXTJDYDSKFEG-UHFFFAOYSA-N |
| XLogP | 13.71 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.08 |
| LogP ≤ 5 | 13.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|